C26H27NO7S — CID 15309474
benzyl (4aS,8R,8aS)-8-acetyloxy-2-(4-methylphenyl)sulfonyl-1-oxo-4,4a,5,8-tetrahydro-3H-isoquinoline-8a-carboxylate (PubChem CID 15309474) has the molecular formula C26H27NO7S and a molecular weight of 497.57 g/mol. Its IUPAC name is benzyl (4aS,8R,8aS)-8-acetyloxy-2-(4-methylphenyl)sulfonyl-1-oxo-4,4a,5,8-tetrahydro-3H-isoquinoline-8a-carboxylate.
| Compound Name | benzyl (4aS,8R,8aS)-8-acetyloxy-2-(4-methylphenyl)sulfonyl-1-oxo-4,4a,5,8-tetrahydro-3H-isoquinoline-8a-carboxylate |
|---|---|
| PubChem CID | 15309474 |
| Molecular Formula | C26H27NO7S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | benzyl (4aS,8R,8aS)-8-acetyloxy-2-(4-methylphenyl)sulfonyl-1-oxo-4,4a,5,8-tetrahydro-3H-isoquinoline-8a-carboxylate |
| SMILES | CC(=O)O[C@@H]1C=CC[C@H]2CCN(S(=O)(=O)c3ccc(C)cc3)C(=O)[C@]21C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H27NO7S/c1-18-11-13-22(14-12-18)35(31,32)27-16-15-21-9-6-10-23(34-19(2)28)26(21,24(27)29)25(30)33-17-20-7-4-3-5-8-20/h3-8,10-14,21,23H,9,15-17H2,1-2H3/t21-,23+,26-/m0/s1 |
| InChIKey | VHEPURBGHBCPHT-SYVJQLTCSA-N |
| XLogP | 3.15 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|