C27H33NO6SSi — CID 15309461
benzyl (4aS,8S,8aS)-2-(4-methylphenyl)sulfonyl-1-oxo-8-trimethylsilyloxy-4,4a,5,8-tetrahydro-3H-isoquinoline-8a-carboxylate (PubChem CID 15309461) has the molecular formula C27H33NO6SSi and a molecular weight of 527.72 g/mol. Its IUPAC name is benzyl (4aS,8S,8aS)-2-(4-methylphenyl)sulfonyl-1-oxo-8-trimethylsilyloxy-4,4a,5,8-tetrahydro-3H-isoquinoline-8a-carboxylate.
| Compound Name | benzyl (4aS,8S,8aS)-2-(4-methylphenyl)sulfonyl-1-oxo-8-trimethylsilyloxy-4,4a,5,8-tetrahydro-3H-isoquinoline-8a-carboxylate |
|---|---|
| PubChem CID | 15309461 |
| Molecular Formula | C27H33NO6SSi |
| Molecular Weight | 527.72 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | benzyl (4aS,8S,8aS)-2-(4-methylphenyl)sulfonyl-1-oxo-8-trimethylsilyloxy-4,4a,5,8-tetrahydro-3H-isoquinoline-8a-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@@H]3CC=C[C@H](O[Si](C)(C)C)[C@]3(C(=O)OCc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C27H33NO6SSi/c1-20-13-15-23(16-14-20)35(31,32)28-18-17-22-11-8-12-24(34-36(2,3)4)27(22,25(28)29)26(30)33-19-21-9-6-5-7-10-21/h5-10,12-16,22,24H,11,17-19H2,1-4H3/t22-,24-,27-/m0/s1 |
| InChIKey | KDYOUWOMYNGQBI-DPPGTGKWSA-N |
| XLogP | 4.44 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.72 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|