C25H27NO7S — CID 15309456
benzyl (4aR,8R,8aS)-8-methoxy-2-(4-methylphenyl)sulfonyl-1,6-dioxo-3,4,4a,5,7,8-hexahydroisoquinoline-8a-carboxylate (PubChem CID 15309456) has the molecular formula C25H27NO7S and a molecular weight of 485.56 g/mol. Its IUPAC name is benzyl (4aR,8R,8aS)-8-methoxy-2-(4-methylphenyl)sulfonyl-1,6-dioxo-3,4,4a,5,7,8-hexahydroisoquinoline-8a-carboxylate.
| Compound Name | benzyl (4aR,8R,8aS)-8-methoxy-2-(4-methylphenyl)sulfonyl-1,6-dioxo-3,4,4a,5,7,8-hexahydroisoquinoline-8a-carboxylate |
|---|---|
| PubChem CID | 15309456 |
| Molecular Formula | C25H27NO7S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | benzyl (4aR,8R,8aS)-8-methoxy-2-(4-methylphenyl)sulfonyl-1,6-dioxo-3,4,4a,5,7,8-hexahydroisoquinoline-8a-carboxylate |
| SMILES | CO[C@@H]1CC(=O)C[C@H]2CCN(S(=O)(=O)c3ccc(C)cc3)C(=O)[C@]21C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H27NO7S/c1-17-8-10-21(11-9-17)34(30,31)26-13-12-19-14-20(27)15-22(32-2)25(19,23(26)28)24(29)33-16-18-6-4-3-5-7-18/h3-11,19,22H,12-16H2,1-2H3/t19-,22-,25+/m1/s1 |
| InChIKey | DKJWLWACRCEIPB-QNIAMRLHSA-N |
| XLogP | 2.64 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|