C24H23NO6S — CID 15309457
benzyl (4aR,8aS)-2-(4-methylphenyl)sulfonyl-1,6-dioxo-3,4,4a,5-tetrahydroisoquinoline-8a-carboxylate (PubChem CID 15309457) has the molecular formula C24H23NO6S and a molecular weight of 453.52 g/mol. Its IUPAC name is benzyl (4aR,8aS)-2-(4-methylphenyl)sulfonyl-1,6-dioxo-3,4,4a,5-tetrahydroisoquinoline-8a-carboxylate.
| Compound Name | benzyl (4aR,8aS)-2-(4-methylphenyl)sulfonyl-1,6-dioxo-3,4,4a,5-tetrahydroisoquinoline-8a-carboxylate |
|---|---|
| PubChem CID | 15309457 |
| Molecular Formula | C24H23NO6S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | benzyl (4aR,8aS)-2-(4-methylphenyl)sulfonyl-1,6-dioxo-3,4,4a,5-tetrahydroisoquinoline-8a-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@@H]3CC(=O)C=C[C@]3(C(=O)OCc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C24H23NO6S/c1-17-7-9-21(10-8-17)32(29,30)25-14-12-19-15-20(26)11-13-24(19,22(25)27)23(28)31-16-18-5-3-2-4-6-18/h2-11,13,19H,12,14-16H2,1H3/t19-,24-/m1/s1 |
| InChIKey | MWOSVFVFTFTLCO-NTKDMRAZSA-N |
| XLogP | 2.79 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|