C30H37NO7SSi — CID 15468840
benzyl (4S,4aS,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-2-(4-methylphenyl)sulfonyl-1,6-dioxo-3,4,4a,5-tetrahydroisoquinoline-8a-carboxylate (PubChem CID 15468840) has the molecular formula C30H37NO7SSi and a molecular weight of 583.78 g/mol. Its IUPAC name is benzyl (4S,4aS,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-2-(4-methylphenyl)sulfonyl-1,6-dioxo-3,4,4a,5-tetrahydroisoquinoline-8a-carboxylate.
| Compound Name | benzyl (4S,4aS,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-2-(4-methylphenyl)sulfonyl-1,6-dioxo-3,4,4a,5-tetrahydroisoquinoline-8a-carboxylate |
|---|---|
| PubChem CID | 15468840 |
| Molecular Formula | C30H37NO7SSi |
| Molecular Weight | 583.78 g/mol |
| Exact Mass | 583.21 |
| IUPAC Name | benzyl (4S,4aS,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-2-(4-methylphenyl)sulfonyl-1,6-dioxo-3,4,4a,5-tetrahydroisoquinoline-8a-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]3CC(=O)C=C[C@@]3(C(=O)OCc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C30H37NO7SSi/c1-21-12-14-24(15-13-21)39(35,36)31-19-26(38-40(5,6)29(2,3)4)25-18-23(32)16-17-30(25,27(31)33)28(34)37-20-22-10-8-7-9-11-22/h7-17,25-26H,18-20H2,1-6H3/t25-,26-,30+/m1/s1 |
| InChIKey | FFCABPMSXMWYLE-MQNCWCGJSA-N |
| XLogP | 4.79 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.78 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|