C25H27NO7S — CID 10907043
benzyl (3R,4R)-1-(4-methylphenyl)sulfonyl-2-oxo-3-(2-oxoethyl)-4-(2-oxopropyl)piperidine-3-carboxylate (PubChem CID 10907043) has the molecular formula C25H27NO7S and a molecular weight of 485.56 g/mol. Its IUPAC name is benzyl (3R,4R)-1-(4-methylphenyl)sulfonyl-2-oxo-3-(2-oxoethyl)-4-(2-oxopropyl)piperidine-3-carboxylate.
| Compound Name | benzyl (3R,4R)-1-(4-methylphenyl)sulfonyl-2-oxo-3-(2-oxoethyl)-4-(2-oxopropyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 10907043 |
| Molecular Formula | C25H27NO7S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | benzyl (3R,4R)-1-(4-methylphenyl)sulfonyl-2-oxo-3-(2-oxoethyl)-4-(2-oxopropyl)piperidine-3-carboxylate |
| SMILES | CC(=O)C[C@H]1CCN(S(=O)(=O)c2ccc(C)cc2)C(=O)[C@]1(CC=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H27NO7S/c1-18-8-10-22(11-9-18)34(31,32)26-14-12-21(16-19(2)28)25(13-15-27,23(26)29)24(30)33-17-20-6-4-3-5-7-20/h3-11,15,21H,12-14,16-17H2,1-2H3/t21-,25-/m1/s1 |
| InChIKey | TWGMOBUDYDSCML-PXDATVDWSA-N |
| XLogP | 2.83 |
| TPSA | 114.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|