C26H25NO5SSe — CID 15468830
benzyl 1-(4-methylphenyl)sulfonyl-2-oxo-3-phenylselanylpiperidine-3-carboxylate (PubChem CID 15468830) has the molecular formula C26H25NO5SSe and a molecular weight of 542.52 g/mol. Its IUPAC name is benzyl 1-(4-methylphenyl)sulfonyl-2-oxo-3-phenylselanylpiperidine-3-carboxylate.
| Compound Name | benzyl 1-(4-methylphenyl)sulfonyl-2-oxo-3-phenylselanylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 15468830 |
| Molecular Formula | C26H25NO5SSe |
| Molecular Weight | 542.52 g/mol |
| Exact Mass | 543.06 |
| IUPAC Name | benzyl 1-(4-methylphenyl)sulfonyl-2-oxo-3-phenylselanylpiperidine-3-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC([Se]c3ccccc3)(C(=O)OCc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C26H25NO5SSe/c1-20-13-15-22(16-14-20)33(30,31)27-18-8-17-26(24(27)28,34-23-11-6-3-7-12-23)25(29)32-19-21-9-4-2-5-10-21/h2-7,9-16H,8,17-19H2,1H3 |
| InChIKey | DUNJPOQGSCAQOU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|