C20H18N3+ — CID 153102145
2-(1,5-dimethylpyrazin-1-ium-2-yl)-3-methylphenanthridine (PubChem CID 153102145) has the molecular formula C20H18N3+ and a molecular weight of 300.39 g/mol. Its IUPAC name is 2-(1,5-dimethylpyrazin-1-ium-2-yl)-3-methylphenanthridine.
| Compound Name | 2-(1,5-dimethylpyrazin-1-ium-2-yl)-3-methylphenanthridine |
|---|---|
| PubChem CID | 153102145 |
| Molecular Formula | C20H18N3+ |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 2-(1,5-dimethylpyrazin-1-ium-2-yl)-3-methylphenanthridine |
| SMILES | Cc1c[n+](C)c(-c2cc3c(cc2C)ncc2ccccc23)cn1 |
| InChI | InChI=1S/C20H18N3/c1-13-8-19-18(16-7-5-4-6-15(16)10-22-19)9-17(13)20-11-21-14(2)12-23(20)3/h4-12H,1-3H3/q+1 |
| InChIKey | AGCVEZLVXLUGSL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 29.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|