About O-butyl [1-(oxiran-2-ylmethoxy)-3-phenylpropan-2-yl]sulfanylmethanethioate
O-butyl [1-(oxiran-2-ylmethoxy)-3-phenylpropan-2-yl]sulfanylmethanethioate (PubChem CID 15311506) has the molecular formula C17H24O3S2
and a molecular weight of 340.51 g/mol. Its IUPAC name is O-butyl [1-(oxiran-2-ylmethoxy)-3-phenylpropan-2-yl]sulfanylmethanethioate.
Molecular Properties
| Compound Name | O-butyl [1-(oxiran-2-ylmethoxy)-3-phenylpropan-2-yl]sulfanylmethanethioate |
| PubChem CID | 15311506 |
| Molecular Formula | C17H24O3S2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | O-butyl [1-(oxiran-2-ylmethoxy)-3-phenylpropan-2-yl]sulfanylmethanethioate |
| SMILES | CCCCOC(=S)SC(COCC1CO1)Cc1ccccc1 |
| InChI | InChI=1S/C17H24O3S2/c1-2-3-9-19-17(21)22-16(13-18-11-15-12-20-15)10-14-7-5-4-6-8-14/h4-8,15-16H,2-3,9-13H2,1H3 |
| InChIKey | JBESXCXCXVXIKF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze O-butyl [1-(oxiran-2-ylmethoxy)-3-phenylpropan-2-yl]sulfanylmethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-butyl [1-(oxiran-2-ylmethoxy)-3-phenylpropan-2-yl]sulfanylmethanethioate?
The IUPAC name of O-butyl [1-(oxiran-2-ylmethoxy)-3-phenylpropan-2-yl]sulfanylmethanethioate (CID 15311506) is O-butyl [1-(oxiran-2-ylmethoxy)-3-phenylpropan-2-yl]sulfanylmethanethioate.
What is the SMILES notation for O-butyl [1-(oxiran-2-ylmethoxy)-3-phenylpropan-2-yl]sulfanylmethanethioate?
The canonical SMILES for O-butyl [1-(oxiran-2-ylmethoxy)-3-phenylpropan-2-yl]sulfanylmethanethioate is CCCCOC(=S)SC(COCC1CO1)Cc1ccccc1.
What is the InChIKey of O-butyl [1-(oxiran-2-ylmethoxy)-3-phenylpropan-2-yl]sulfanylmethanethioate?
The InChIKey is JBESXCXCXVXIKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O3S2/c1-2-3-9-19-17(21)22-16(13-18-11-15-12-20-15)10-14-7-5-4-6-8-14/h4-8,15-16H,2-3,9-13H2,1H3.
What are the key properties of O-butyl [1-(oxiran-2-ylmethoxy)-3-phenylpropan-2-yl]sulfanylmethanethioate?
O-butyl [1-(oxiran-2-ylmethoxy)-3-phenylpropan-2-yl]sulfanylmethanethioate has a molecular weight of 340.51 g/mol, XLogP of 3.85, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for O-butyl [1-(oxiran-2-ylmethoxy)-3-phenylpropan-2-yl]sulfanylmethanethioate is sourced from PubChem (CID 15311506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).