C10H19NO — CID 153138661
(2Z,4E)-7-(ethylamino)-3-methylhepta-2,4-dien-4-ol (PubChem CID 153138661) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is (2Z,4E)-7-(ethylamino)-3-methylhepta-2,4-dien-4-ol.
| Compound Name | (2Z,4E)-7-(ethylamino)-3-methylhepta-2,4-dien-4-ol |
|---|---|
| PubChem CID | 153138661 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (2Z,4E)-7-(ethylamino)-3-methylhepta-2,4-dien-4-ol |
| SMILES | C/C=C(C)\C(O)=C/CCNCC |
| InChI | InChI=1S/C10H19NO/c1-4-9(3)10(12)7-6-8-11-5-2/h4,7,11-12H,5-6,8H2,1-3H3/b9-4-,10-7+ |
| InChIKey | VYEGJZMXBTZAOS-SWSBUGGLSA-N |
| XLogP | 2.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|