C30H22N12O4S2 — CID 153157083
2-N-[2-[[2-[[4-amino-6-(3-nitrophenyl)-1,3,5-triazin-2-yl]amino]phenyl]disulfanyl]phenyl]-6-(3-nitrophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 153157083) has the molecular formula C30H22N12O4S2 and a molecular weight of 678.72 g/mol. Its IUPAC name is 2-N-[2-[[2-[[4-amino-6-(3-nitrophenyl)-1,3,5-triazin-2-yl]amino]phenyl]disulfanyl]phenyl]-6-(3-nitrophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[2-[[2-[[4-amino-6-(3-nitrophenyl)-1,3,5-triazin-2-yl]amino]phenyl]disulfanyl]phenyl]-6-(3-nitrophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 153157083 |
| Molecular Formula | C30H22N12O4S2 |
| Molecular Weight | 678.72 g/mol |
| Exact Mass | 678.13 |
| IUPAC Name | 2-N-[2-[[2-[[4-amino-6-(3-nitrophenyl)-1,3,5-triazin-2-yl]amino]phenyl]disulfanyl]phenyl]-6-(3-nitrophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(Nc2ccccc2SSc2ccccc2Nc2nc(N)nc(-c3cccc([N+](=O)[O-])c3)n2)nc(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C30H22N12O4S2/c31-27-35-25(17-7-5-9-19(15-17)41(43)44)37-29(39-27)33-21-11-1-3-13-23(21)47-48-24-14-4-2-12-22(24)34-30-38-26(36-28(32)40-30)18-8-6-10-20(16-18)42(45)46/h1-16H,(H3,31,33,35,37,39)(H3,32,34,36,38,40) |
| InChIKey | WBPWSEVOTORYKP-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 239.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.72 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|