C33H23N11S2 — CID 158517050
3-[4-amino-6-[2-[[2-[[4-amino-6-(3-ethynylphenyl)-1,3,5-triazin-2-yl]amino]phenyl]disulfanyl]anilino]-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 158517050) has the molecular formula C33H23N11S2 and a molecular weight of 637.76 g/mol. Its IUPAC name is 3-[4-amino-6-[2-[[2-[[4-amino-6-(3-ethynylphenyl)-1,3,5-triazin-2-yl]amino]phenyl]disulfanyl]anilino]-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 3-[4-amino-6-[2-[[2-[[4-amino-6-(3-ethynylphenyl)-1,3,5-triazin-2-yl]amino]phenyl]disulfanyl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 158517050 |
| Molecular Formula | C33H23N11S2 |
| Molecular Weight | 637.76 g/mol |
| Exact Mass | 637.16 |
| IUPAC Name | 3-[4-amino-6-[2-[[2-[[4-amino-6-(3-ethynylphenyl)-1,3,5-triazin-2-yl]amino]phenyl]disulfanyl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | C#Cc1cccc(-c2nc(N)nc(Nc3ccccc3SSc3ccccc3Nc3nc(N)nc(-c4cccc(C#N)c4)n3)n2)c1 |
| InChI | InChI=1S/C33H23N11S2/c1-2-20-9-7-11-22(17-20)28-39-30(35)43-32(41-28)37-24-13-3-5-15-26(24)45-46-27-16-6-4-14-25(27)38-33-42-29(40-31(36)44-33)23-12-8-10-21(18-23)19-34/h1,3-18H,(H3,35,37,39,41,43)(H3,36,38,40,42,44) |
| InChIKey | IZGXFBPAULVVSS-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 177.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.76 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|