C35H26N3OPtS- — CID 153280285
2-[6-(2,6-dimethylphenyl)-2-(3-phenyl-5-pyridin-2-ylsulfanylbenzene-6-id-1-yl)pyrimidin-4-yl]phenol;platinum (PubChem CID 153280285) has the molecular formula C35H26N3OPtS- and a molecular weight of 731.76 g/mol. Its IUPAC name is 2-[6-(2,6-dimethylphenyl)-2-(3-phenyl-5-pyridin-2-ylsulfanylbenzene-6-id-1-yl)pyrimidin-4-yl]phenol;platinum.
| Compound Name | 2-[6-(2,6-dimethylphenyl)-2-(3-phenyl-5-pyridin-2-ylsulfanylbenzene-6-id-1-yl)pyrimidin-4-yl]phenol;platinum |
|---|---|
| PubChem CID | 153280285 |
| Molecular Formula | C35H26N3OPtS- |
| Molecular Weight | 731.76 g/mol |
| Exact Mass | 731.14 |
| IUPAC Name | 2-[6-(2,6-dimethylphenyl)-2-(3-phenyl-5-pyridin-2-ylsulfanylbenzene-6-id-1-yl)pyrimidin-4-yl]phenol;platinum |
| SMILES | Cc1cccc(C)c1-c1cc(-c2ccccc2O)nc(-c2[c-]c(Sc3ccccn3)cc(-c3ccccc3)c2)n1.[Pt] |
| InChI | InChI=1S/C35H26N3OS.Pt/c1-23-11-10-12-24(2)34(23)31-22-30(29-15-6-7-16-32(29)39)37-35(38-31)27-19-26(25-13-4-3-5-14-25)20-28(21-27)40-33-17-8-9-18-36-33;/h3-20,22,39H,1-2H3;/q-1; |
| InChIKey | ILHPCCGHNJZLID-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.76 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|