C33H30N3OPtS- — CID 153280311
2-[2-(3-tert-butyl-5-pyridin-2-ylsulfanylbenzene-6-id-1-yl)-6-(2,6-dimethylphenyl)pyrimidin-4-yl]phenol;platinum (PubChem CID 153280311) has the molecular formula C33H30N3OPtS- and a molecular weight of 711.77 g/mol. Its IUPAC name is 2-[2-(3-tert-butyl-5-pyridin-2-ylsulfanylbenzene-6-id-1-yl)-6-(2,6-dimethylphenyl)pyrimidin-4-yl]phenol;platinum.
| Compound Name | 2-[2-(3-tert-butyl-5-pyridin-2-ylsulfanylbenzene-6-id-1-yl)-6-(2,6-dimethylphenyl)pyrimidin-4-yl]phenol;platinum |
|---|---|
| PubChem CID | 153280311 |
| Molecular Formula | C33H30N3OPtS- |
| Molecular Weight | 711.77 g/mol |
| Exact Mass | 711.18 |
| IUPAC Name | 2-[2-(3-tert-butyl-5-pyridin-2-ylsulfanylbenzene-6-id-1-yl)-6-(2,6-dimethylphenyl)pyrimidin-4-yl]phenol;platinum |
| SMILES | Cc1cccc(C)c1-c1cc(-c2ccccc2O)nc(-c2[c-]c(Sc3ccccn3)cc(C(C)(C)C)c2)n1.[Pt] |
| InChI | InChI=1S/C33H30N3OS.Pt/c1-21-11-10-12-22(2)31(21)28-20-27(26-13-6-7-14-29(26)37)35-32(36-28)23-17-24(33(3,4)5)19-25(18-23)38-30-15-8-9-16-34-30;/h6-17,19-20,37H,1-5H3;/q-1; |
| InChIKey | JLXVGIIRCRGHQL-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.77 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|