C41H30N3OPtS- — CID 153280401
2-[6-(2,6-dimethylphenyl)-2-[3-(4-phenylphenyl)-5-pyridin-2-ylsulfanylbenzene-6-id-1-yl]pyrimidin-4-yl]phenol;platinum (PubChem CID 153280401) has the molecular formula C41H30N3OPtS- and a molecular weight of 807.86 g/mol. Its IUPAC name is 2-[6-(2,6-dimethylphenyl)-2-[3-(4-phenylphenyl)-5-pyridin-2-ylsulfanylbenzene-6-id-1-yl]pyrimidin-4-yl]phenol;platinum.
| Compound Name | 2-[6-(2,6-dimethylphenyl)-2-[3-(4-phenylphenyl)-5-pyridin-2-ylsulfanylbenzene-6-id-1-yl]pyrimidin-4-yl]phenol;platinum |
|---|---|
| PubChem CID | 153280401 |
| Molecular Formula | C41H30N3OPtS- |
| Molecular Weight | 807.86 g/mol |
| Exact Mass | 807.18 |
| IUPAC Name | 2-[6-(2,6-dimethylphenyl)-2-[3-(4-phenylphenyl)-5-pyridin-2-ylsulfanylbenzene-6-id-1-yl]pyrimidin-4-yl]phenol;platinum |
| SMILES | Cc1cccc(C)c1-c1cc(-c2ccccc2O)nc(-c2[c-]c(Sc3ccccn3)cc(-c3ccc(-c4ccccc4)cc3)c2)n1.[Pt] |
| InChI | InChI=1S/C41H30N3OS.Pt/c1-27-11-10-12-28(2)40(27)37-26-36(35-15-6-7-16-38(35)45)43-41(44-37)33-23-32(24-34(25-33)46-39-17-8-9-22-42-39)31-20-18-30(19-21-31)29-13-4-3-5-14-29;/h3-24,26,45H,1-2H3;/q-1; |
| InChIKey | NPIICKNYSMJVJS-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.86 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|