C38H35N4OPtS- — CID 153280435
2,4-ditert-butyl-6-[4-[3-(2,6-naphthyridin-3-ylsulfanyl)benzene-2-id-1-yl]-6-phenylpyrimidin-2-yl]phenol;platinum (PubChem CID 153280435) has the molecular formula C38H35N4OPtS- and a molecular weight of 790.87 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[4-[3-(2,6-naphthyridin-3-ylsulfanyl)benzene-2-id-1-yl]-6-phenylpyrimidin-2-yl]phenol;platinum.
| Compound Name | 2,4-ditert-butyl-6-[4-[3-(2,6-naphthyridin-3-ylsulfanyl)benzene-2-id-1-yl]-6-phenylpyrimidin-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 153280435 |
| Molecular Formula | C38H35N4OPtS- |
| Molecular Weight | 790.87 g/mol |
| Exact Mass | 790.22 |
| IUPAC Name | 2,4-ditert-butyl-6-[4-[3-(2,6-naphthyridin-3-ylsulfanyl)benzene-2-id-1-yl]-6-phenylpyrimidin-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2nc(-c3[c-]c(Sc4cc5cnccc5cn4)ccc3)cc(-c3ccccc3)n2)c(O)c(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C38H35N4OS.Pt/c1-37(2,3)28-19-30(35(43)31(20-28)38(4,5)6)36-41-32(24-11-8-7-9-12-24)21-33(42-36)25-13-10-14-29(17-25)44-34-18-27-22-39-16-15-26(27)23-40-34;/h7-16,18-23,43H,1-6H3;/q-1; |
| InChIKey | CPASFCFRLWTQSB-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 71.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.87 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|