C18H15F2O3S- — CID 153282818
1,1-difluoro-2-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethanesulfonate (PubChem CID 153282818) has the molecular formula C18H15F2O3S- and a molecular weight of 349.38 g/mol. Its IUPAC name is 1,1-difluoro-2-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethanesulfonate.
| Compound Name | 1,1-difluoro-2-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethanesulfonate |
|---|---|
| PubChem CID | 153282818 |
| Molecular Formula | C18H15F2O3S- |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 1,1-difluoro-2-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)CC1CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C18H16F2O3S/c19-18(20,24(21,22)23)10-11-9-16-12-5-1-3-7-14(12)17(11)15-8-4-2-6-13(15)16/h1-8,11,16-17H,9-10H2,(H,21,22,23)/p-1 |
| InChIKey | KGHNORXSLCWKCP-UHFFFAOYSA-M |
| XLogP | 3.81 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|