C31H50N2P2 — CID 153284866
1-ditert-butylphosphanyl-1-[6-(ditert-butylphosphanylmethyl)-2-pyridinyl]-3-phenylpropan-2-imine (PubChem CID 153284866) has the molecular formula C31H50N2P2 and a molecular weight of 512.70 g/mol. Its IUPAC name is 1-ditert-butylphosphanyl-1-[6-(ditert-butylphosphanylmethyl)-2-pyridinyl]-3-phenylpropan-2-imine.
| Compound Name | 1-ditert-butylphosphanyl-1-[6-(ditert-butylphosphanylmethyl)-2-pyridinyl]-3-phenylpropan-2-imine |
|---|---|
| PubChem CID | 153284866 |
| Molecular Formula | C31H50N2P2 |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.34 |
| IUPAC Name | 1-ditert-butylphosphanyl-1-[6-(ditert-butylphosphanylmethyl)-2-pyridinyl]-3-phenylpropan-2-imine |
| SMILES | [H]/N=C(\Cc1ccccc1)C(c1cccc(CP(C(C)(C)C)C(C)(C)C)n1)P(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C31H50N2P2/c1-28(2,3)34(29(4,5)6)22-24-19-16-20-26(33-24)27(35(30(7,8)9)31(10,11)12)25(32)21-23-17-14-13-15-18-23/h13-20,27,32H,21-22H2,1-12H3/b32-25+ |
| InChIKey | BCOXMQMYVPSDDU-WGPBWIAQSA-N |
| XLogP | 10.04 |
| TPSA | 36.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|