C29H25F2N3O6S — CID 153289752
[3-(3-fluoro-1-bicyclo[1.1.1]pentanyl)-1-[(11S)-8-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-4,6-dioxo-2H-pyrido[2,1-f][1,2,4]triazin-5-yl]oxymethyl methyl carbonate (PubChem CID 153289752) has the molecular formula C29H25F2N3O6S and a molecular weight of 581.60 g/mol. Its IUPAC name is [3-(3-fluoro-1-bicyclo[1.1.1]pentanyl)-1-[(11S)-8-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-4,6-dioxo-2H-pyrido[2,1-f][1,2,4]triazin-5-yl]oxymethyl methyl carbonate.
| Compound Name | [3-(3-fluoro-1-bicyclo[1.1.1]pentanyl)-1-[(11S)-8-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-4,6-dioxo-2H-pyrido[2,1-f][1,2,4]triazin-5-yl]oxymethyl methyl carbonate |
|---|---|
| PubChem CID | 153289752 |
| Molecular Formula | C29H25F2N3O6S |
| Molecular Weight | 581.60 g/mol |
| Exact Mass | 581.14 |
| IUPAC Name | [3-(3-fluoro-1-bicyclo[1.1.1]pentanyl)-1-[(11S)-8-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-4,6-dioxo-2H-pyrido[2,1-f][1,2,4]triazin-5-yl]oxymethyl methyl carbonate |
| SMILES | COC(=O)OCOc1c2n(ccc1=O)N([C@H]1c3ccc(F)cc3CSc3ccccc31)CN(C13CC(F)(C1)C3)C2=O |
| InChI | InChI=1S/C29H25F2N3O6S/c1-38-27(37)40-16-39-25-21(35)8-9-33-24(25)26(36)32(29-12-28(31,13-29)14-29)15-34(33)23-19-7-6-18(30)10-17(19)11-41-22-5-3-2-4-20(22)23/h2-10,23H,11-16H2,1H3/t23-,28?,29?/m0/s1 |
| InChIKey | OSNQWOFRKDCYSD-SAVAPUMLSA-N |
| XLogP | 4.50 |
| TPSA | 90.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|