C32H27F2N3O6S — CID 155705306
[(1R,2S)-18-[(11R)-8,9-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-11,14-dioxo-10,17,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-4,6,12,15-tetraen-13-yl]oxymethyl methyl carbonate (PubChem CID 155705306) has the molecular formula C32H27F2N3O6S and a molecular weight of 619.65 g/mol. Its IUPAC name is [(1R,2S)-18-[(11R)-8,9-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-11,14-dioxo-10,17,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-4,6,12,15-tetraen-13-yl]oxymethyl methyl carbonate.
| Compound Name | [(1R,2S)-18-[(11R)-8,9-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-11,14-dioxo-10,17,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-4,6,12,15-tetraen-13-yl]oxymethyl methyl carbonate |
|---|---|
| PubChem CID | 155705306 |
| Molecular Formula | C32H27F2N3O6S |
| Molecular Weight | 619.65 g/mol |
| Exact Mass | 619.16 |
| IUPAC Name | [(1R,2S)-18-[(11R)-8,9-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-11,14-dioxo-10,17,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-4,6,12,15-tetraen-13-yl]oxymethyl methyl carbonate |
| SMILES | COC(=O)OCOc1c2n(ccc1=O)N([C@@H]1c3cc(F)c(F)cc3CSc3ccccc31)[C@@H]1[C@H]3CC=CC=C3CCN1C2=O |
| InChI | InChI=1S/C32H27F2N3O6S/c1-41-32(40)43-17-42-29-25(38)11-13-36-28(29)31(39)35-12-10-18-6-2-3-7-20(18)30(35)37(36)27-21-8-4-5-9-26(21)44-16-19-14-23(33)24(34)15-22(19)27/h2-6,8-9,11,13-15,20,27,30H,7,10,12,16-17H2,1H3/t20-,27-,30+/m0/s1 |
| InChIKey | CONVATSWVDPGLT-DJQFERDUSA-N |
| XLogP | 5.27 |
| TPSA | 90.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.65 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|