C24H42F8O16 — CID 153290145
[2-[3,4-bis[1,3-bis(fluoromethoxy)propan-2-yloxy]-1-[1-(2-fluorooxyethoxy)-3-fluoroperoxypropan-2-yl]oxybutan-2-yl]oxy-3-(2-fluorooxyethoxy)propoxy] hypofluorite (PubChem CID 153290145) has the molecular formula C24H42F8O16 and a molecular weight of 738.57 g/mol. Its IUPAC name is [2-[3,4-bis[1,3-bis(fluoromethoxy)propan-2-yloxy]-1-[1-(2-fluorooxyethoxy)-3-fluoroperoxypropan-2-yl]oxybutan-2-yl]oxy-3-(2-fluorooxyethoxy)propoxy] hypofluorite.
| Compound Name | [2-[3,4-bis[1,3-bis(fluoromethoxy)propan-2-yloxy]-1-[1-(2-fluorooxyethoxy)-3-fluoroperoxypropan-2-yl]oxybutan-2-yl]oxy-3-(2-fluorooxyethoxy)propoxy] hypofluorite |
|---|---|
| PubChem CID | 153290145 |
| Molecular Formula | C24H42F8O16 |
| Molecular Weight | 738.57 g/mol |
| Exact Mass | 738.23 |
| IUPAC Name | [2-[3,4-bis[1,3-bis(fluoromethoxy)propan-2-yloxy]-1-[1-(2-fluorooxyethoxy)-3-fluoroperoxypropan-2-yl]oxybutan-2-yl]oxy-3-(2-fluorooxyethoxy)propoxy] hypofluorite |
| SMILES | FCOCC(COCF)OCC(OC(COCF)COCF)C(COC(COCCOF)COOF)OC(COCCOF)COOF |
| InChI | InChI=1S/C24H42F8O16/c25-15-35-6-19(7-36-16-26)39-13-23(45-21(9-37-17-27)10-38-18-28)24(46-22(12-44-48-32)8-34-2-4-42-30)14-40-20(11-43-47-31)5-33-1-3-41-29/h19-24H,1-18H2 |
| InChIKey | BQAFBHQJRKIZMW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 147.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.57 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|