C28H50F8O21 — CID 153290156
[1-[2-[1,3-bis[2,3-bis(2-fluorooxyethoxy)propoxy]propan-2-yloxy]-3-[2,3-bis(fluoroperoxy)propoxy]propoxy]-3-(2-fluorooxyethoxy)propan-2-yl]oxy hypofluorite (PubChem CID 153290156) has the molecular formula C28H50F8O21 and a molecular weight of 874.67 g/mol. Its IUPAC name is [1-[2-[1,3-bis[2,3-bis(2-fluorooxyethoxy)propoxy]propan-2-yloxy]-3-[2,3-bis(fluoroperoxy)propoxy]propoxy]-3-(2-fluorooxyethoxy)propan-2-yl]oxy hypofluorite.
| Compound Name | [1-[2-[1,3-bis[2,3-bis(2-fluorooxyethoxy)propoxy]propan-2-yloxy]-3-[2,3-bis(fluoroperoxy)propoxy]propoxy]-3-(2-fluorooxyethoxy)propan-2-yl]oxy hypofluorite |
|---|---|
| PubChem CID | 153290156 |
| Molecular Formula | C28H50F8O21 |
| Molecular Weight | 874.67 g/mol |
| Exact Mass | 874.27 |
| IUPAC Name | [1-[2-[1,3-bis[2,3-bis(2-fluorooxyethoxy)propoxy]propan-2-yloxy]-3-[2,3-bis(fluoroperoxy)propoxy]propoxy]-3-(2-fluorooxyethoxy)propan-2-yl]oxy hypofluorite |
| SMILES | FOCCOCC(COCC(COCC(COCCOF)OCCOF)OC(COCC(COCCOF)OOF)COCC(COOF)OOF)OCCOF |
| InChI | InChI=1S/C28H50F8O21/c29-46-6-1-37-11-23(44-4-9-49-32)13-40-15-25(16-41-14-24(45-5-10-50-33)12-38-2-7-47-30)52-26(18-43-21-28(54-57-36)22-51-55-34)17-42-20-27(53-56-35)19-39-3-8-48-31/h23-28H,1-22H2 |
| InChIKey | FPLDJTCGCFJPSQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 193.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.67 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|