C32H58F8O20 — CID 153290233
2-[1-(2-fluorooxyethoxy)-3-[1,3,4-tris[2,3-bis(2-fluorooxyethoxy)propoxy]butan-2-yloxy]propan-2-yl]oxyethyl hypofluorite (PubChem CID 153290233) has the molecular formula C32H58F8O20 and a molecular weight of 914.78 g/mol. Its IUPAC name is 2-[1-(2-fluorooxyethoxy)-3-[1,3,4-tris[2,3-bis(2-fluorooxyethoxy)propoxy]butan-2-yloxy]propan-2-yl]oxyethyl hypofluorite.
| Compound Name | 2-[1-(2-fluorooxyethoxy)-3-[1,3,4-tris[2,3-bis(2-fluorooxyethoxy)propoxy]butan-2-yloxy]propan-2-yl]oxyethyl hypofluorite |
|---|---|
| PubChem CID | 153290233 |
| Molecular Formula | C32H58F8O20 |
| Molecular Weight | 914.78 g/mol |
| Exact Mass | 914.34 |
| IUPAC Name | 2-[1-(2-fluorooxyethoxy)-3-[1,3,4-tris[2,3-bis(2-fluorooxyethoxy)propoxy]butan-2-yloxy]propan-2-yl]oxyethyl hypofluorite |
| SMILES | FOCCOCC(COCC(OCC(COCCOF)OCCOF)C(COCC(COCCOF)OCCOF)OCC(COCCOF)OCCOF)OCCOF |
| InChI | InChI=1S/C32H58F8O20/c33-53-9-1-41-17-27(47-5-13-57-37)21-45-25-31(51-23-29(49-7-15-59-39)19-43-3-11-55-35)32(52-24-30(50-8-16-60-40)20-44-4-12-56-36)26-46-22-28(48-6-14-58-38)18-42-2-10-54-34/h27-32H,1-26H2 |
| InChIKey | FBPDEUOAEFOILM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 184.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.78 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|