C24H43N5O4SSi2 — CID 153295291
(6aS,8R,9R,9aS)-8-(4-amino-3-methylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl)-2,2,4,4-tetra(propan-2-yl)-3,6,6a,8,9,9a-hexahydrofuro[3,2-f][1,5,2,4]dioxadisilocin-9-ol (PubChem CID 153295291) has the molecular formula C24H43N5O4SSi2 and a molecular weight of 553.88 g/mol. Its IUPAC name is (6aS,8R,9R,9aS)-8-(4-amino-3-methylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl)-2,2,4,4-tetra(propan-2-yl)-3,6,6a,8,9,9a-hexahydrofuro[3,2-f][1,5,2,4]dioxadisilocin-9-ol.
| Compound Name | (6aS,8R,9R,9aS)-8-(4-amino-3-methylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl)-2,2,4,4-tetra(propan-2-yl)-3,6,6a,8,9,9a-hexahydrofuro[3,2-f][1,5,2,4]dioxadisilocin-9-ol |
|---|---|
| PubChem CID | 153295291 |
| Molecular Formula | C24H43N5O4SSi2 |
| Molecular Weight | 553.88 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | (6aS,8R,9R,9aS)-8-(4-amino-3-methylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl)-2,2,4,4-tetra(propan-2-yl)-3,6,6a,8,9,9a-hexahydrofuro[3,2-f][1,5,2,4]dioxadisilocin-9-ol |
| SMILES | CSc1nn([C@@H]2O[C@H]3CO[Si](C(C)C)(C(C)C)C[Si](C(C)C)(C(C)C)O[C@H]3[C@H]2O)c2ncnc(N)c12 |
| InChI | InChI=1S/C24H43N5O4SSi2/c1-13(2)35(14(3)4)12-36(15(5)6,16(7)8)33-20-17(10-31-35)32-24(19(20)30)29-22-18(23(28-29)34-9)21(25)26-11-27-22/h11,13-17,19-20,24,30H,10,12H2,1-9H3,(H2,25,26,27)/t17-,19+,20+,24+/m0/s1 |
| InChIKey | FLUYXQCNRJULHQ-CSNZXNIXSA-N |
| XLogP | 4.87 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.88 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|