C23H28BFN2O5 — CID 153297329
trans-ethyl (1S,2S)-2-[5-[[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]pyrazin-2-yl]cyclopropane-1-carboxylate (PubChem CID 153297329) has the molecular formula C23H28BFN2O5 and a molecular weight of 442.30 g/mol. Its IUPAC name is trans-ethyl (1S,2S)-2-[5-[[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]pyrazin-2-yl]cyclopropane-1-carboxylate.
| Compound Name | trans-ethyl (1S,2S)-2-[5-[[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]pyrazin-2-yl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 153297329 |
| Molecular Formula | C23H28BFN2O5 |
| Molecular Weight | 442.30 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | trans-ethyl (1S,2S)-2-[5-[[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]pyrazin-2-yl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@@H]1c1cnc(OCc2cc(B3OC(C)(C)C(C)(C)O3)ccc2F)cn1 |
| InChI | InChI=1S/C23H28BFN2O5/c1-6-29-21(28)17-10-16(17)19-11-27-20(12-26-19)30-13-14-9-15(7-8-18(14)25)24-31-22(2,3)23(4,5)32-24/h7-9,11-12,16-17H,6,10,13H2,1-5H3/t16-,17-/m0/s1 |
| InChIKey | HKWJLPJIRNEEOP-IRXDYDNUSA-N |
| XLogP | 3.16 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|