C20H20F5NO5S — CID 153301439
tert-butyl (2S)-2-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-3-phenylmethoxypropanoate (PubChem CID 153301439) has the molecular formula C20H20F5NO5S and a molecular weight of 481.44 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-3-phenylmethoxypropanoate.
| Compound Name | tert-butyl (2S)-2-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-3-phenylmethoxypropanoate |
|---|---|
| PubChem CID | 153301439 |
| Molecular Formula | C20H20F5NO5S |
| Molecular Weight | 481.44 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | tert-butyl (2S)-2-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-3-phenylmethoxypropanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](COCc1ccccc1)NS(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H20F5NO5S/c1-20(2,3)31-19(27)12(10-30-9-11-7-5-4-6-8-11)26-32(28,29)18-16(24)14(22)13(21)15(23)17(18)25/h4-8,12,26H,9-10H2,1-3H3/t12-/m0/s1 |
| InChIKey | LBNZSIHDYQJTBZ-LBPRGKRZSA-N |
| XLogP | 3.59 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|