C17H26O5 — CID 15330616
(4S)-4-hydroxy-4-[(3S)-3-methoxycyclohexen-1-yl]-2,3-di(propan-2-yloxy)cyclobut-2-en-1-one (PubChem CID 15330616) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is (4S)-4-hydroxy-4-[(3S)-3-methoxycyclohexen-1-yl]-2,3-di(propan-2-yloxy)cyclobut-2-en-1-one.
| Compound Name | (4S)-4-hydroxy-4-[(3S)-3-methoxycyclohexen-1-yl]-2,3-di(propan-2-yloxy)cyclobut-2-en-1-one |
|---|---|
| PubChem CID | 15330616 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | (4S)-4-hydroxy-4-[(3S)-3-methoxycyclohexen-1-yl]-2,3-di(propan-2-yloxy)cyclobut-2-en-1-one |
| SMILES | CO[C@@H]1C=C([C@@]2(O)C(=O)C(OC(C)C)=C2OC(C)C)CCC1 |
| InChI | InChI=1S/C17H26O5/c1-10(2)21-14-15(18)17(19,16(14)22-11(3)4)12-7-6-8-13(9-12)20-5/h9-11,13,19H,6-8H2,1-5H3/t13-,17+/m0/s1 |
| InChIKey | ZOPUIXDOMKHVMO-SUMWQHHRSA-N |
| XLogP | 2.49 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|