C12H15N3O — CID 153307026
(NE)-N-[[(1R,5S)-3-(5-methyl-2-pyridinyl)-3-azabicyclo[3.1.0]hexan-6-yl]methylidene]hydroxylamine (PubChem CID 153307026) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is (NE)-N-[[(1R,5S)-3-(5-methyl-2-pyridinyl)-3-azabicyclo[3.1.0]hexan-6-yl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[(1R,5S)-3-(5-methyl-2-pyridinyl)-3-azabicyclo[3.1.0]hexan-6-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 153307026 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | (NE)-N-[[(1R,5S)-3-(5-methyl-2-pyridinyl)-3-azabicyclo[3.1.0]hexan-6-yl]methylidene]hydroxylamine |
| SMILES | Cc1ccc(N2C[C@@H]3C(/C=N/O)[C@@H]3C2)nc1 |
| InChI | InChI=1S/C12H15N3O/c1-8-2-3-12(13-4-8)15-6-10-9(5-14-16)11(10)7-15/h2-5,9-11,16H,6-7H2,1H3/b14-5+/t9?,10-,11+ |
| InChIKey | FDDFIHIJJMLTEE-OXOOMEOBSA-N |
| XLogP | 1.53 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|