C26H36Cl2SiZr — CID 153307780
(3-butylinden-1-id-1-yl)-diethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane;dichlorozirconium(2+) (PubChem CID 153307780) has the molecular formula C26H36Cl2SiZr and a molecular weight of 538.79 g/mol. Its IUPAC name is (3-butylinden-1-id-1-yl)-diethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane;dichlorozirconium(2+).
| Compound Name | (3-butylinden-1-id-1-yl)-diethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane;dichlorozirconium(2+) |
|---|---|
| PubChem CID | 153307780 |
| Molecular Formula | C26H36Cl2SiZr |
| Molecular Weight | 538.79 g/mol |
| Exact Mass | 536.10 |
| IUPAC Name | (3-butylinden-1-id-1-yl)-diethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane;dichlorozirconium(2+) |
| SMILES | CCCCc1c[c-]([Si](CC)(CC)[c-]2c(C)c(C)c(C)c2C)c2ccccc12.Cl[Zr+2]Cl |
| InChI | InChI=1S/C26H36Si.2ClH.Zr/c1-8-11-14-22-17-25(24-16-13-12-15-23(22)24)27(9-2,10-3)26-20(6)18(4)19(5)21(26)7;;;/h12-13,15-17H,8-11,14H2,1-7H3;2*1H;/q-2;;;+4/p-2 |
| InChIKey | XIUZWICPJSUDKK-UHFFFAOYSA-L |
| XLogP | 7.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.79 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|