C23H22ClF3N2O5 — CID 153324983
2-[5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-methoxyphenyl]-3-methoxy-5-(2-methoxyiminopropyl)cyclopent-2-en-1-one (PubChem CID 153324983) has the molecular formula C23H22ClF3N2O5 and a molecular weight of 498.89 g/mol. Its IUPAC name is 2-[5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-methoxyphenyl]-3-methoxy-5-(2-methoxyiminopropyl)cyclopent-2-en-1-one.
| Compound Name | 2-[5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-methoxyphenyl]-3-methoxy-5-(2-methoxyiminopropyl)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 153324983 |
| Molecular Formula | C23H22ClF3N2O5 |
| Molecular Weight | 498.89 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 2-[5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-methoxyphenyl]-3-methoxy-5-(2-methoxyiminopropyl)cyclopent-2-en-1-one |
| SMILES | CON=C(C)CC1CC(OC)=C(c2cc(Oc3ncc(C(F)(F)F)cc3Cl)ccc2OC)C1=O |
| InChI | InChI=1S/C23H22ClF3N2O5/c1-12(29-33-4)7-13-8-19(32-3)20(21(13)30)16-10-15(5-6-18(16)31-2)34-22-17(24)9-14(11-28-22)23(25,26)27/h5-6,9-11,13H,7-8H2,1-4H3 |
| InChIKey | PNJVRZGTVVHSJP-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 79.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.89 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|