C23H20ClN3O5 — CID 142401758
2-[5-(6-chloroquinoxalin-2-yl)oxy-2-methoxyphenyl]-3-hydroxy-4-(2-hydroxyiminopropyl)cyclopent-2-en-1-one (PubChem CID 142401758) has the molecular formula C23H20ClN3O5 and a molecular weight of 453.88 g/mol. Its IUPAC name is 2-[5-(6-chloroquinoxalin-2-yl)oxy-2-methoxyphenyl]-3-hydroxy-4-(2-hydroxyiminopropyl)cyclopent-2-en-1-one.
| Compound Name | 2-[5-(6-chloroquinoxalin-2-yl)oxy-2-methoxyphenyl]-3-hydroxy-4-(2-hydroxyiminopropyl)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 142401758 |
| Molecular Formula | C23H20ClN3O5 |
| Molecular Weight | 453.88 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 2-[5-(6-chloroquinoxalin-2-yl)oxy-2-methoxyphenyl]-3-hydroxy-4-(2-hydroxyiminopropyl)cyclopent-2-en-1-one |
| SMILES | COc1ccc(Oc2cnc3cc(Cl)ccc3n2)cc1C1=C(O)C(CC(C)=NO)CC1=O |
| InChI | InChI=1S/C23H20ClN3O5/c1-12(27-30)7-13-8-19(28)22(23(13)29)16-10-15(4-6-20(16)31-2)32-21-11-25-18-9-14(24)3-5-17(18)26-21/h3-6,9-11,13,29-30H,7-8H2,1-2H3 |
| InChIKey | MRIYWVNNZNTAER-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 114.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.88 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|