C22H23ClN2O3 — CID 56627761
2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]-2-ethylhexanal (PubChem CID 56627761) has the molecular formula C22H23ClN2O3 and a molecular weight of 398.89 g/mol. Its IUPAC name is 2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]-2-ethylhexanal.
| Compound Name | 2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]-2-ethylhexanal |
|---|---|
| PubChem CID | 56627761 |
| Molecular Formula | C22H23ClN2O3 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]-2-ethylhexanal |
| SMILES | CCCCC(C=O)(CC)Oc1ccc(Oc2cnc3cc(Cl)ccc3n2)cc1 |
| InChI | InChI=1S/C22H23ClN2O3/c1-3-5-12-22(4-2,15-26)28-18-9-7-17(8-10-18)27-21-14-24-20-13-16(23)6-11-19(20)25-21/h6-11,13-15H,3-5,12H2,1-2H3 |
| InChIKey | IECRVVNFSGNBTC-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|