C35H42Si2 — CID 153325067
[9,9-bis(2-phenylethyl)-7-trimethylsilylfluoren-2-yl]-trimethylsilane (PubChem CID 153325067) has the molecular formula C35H42Si2 and a molecular weight of 518.89 g/mol. Its IUPAC name is [9,9-bis(2-phenylethyl)-7-trimethylsilylfluoren-2-yl]-trimethylsilane.
| Compound Name | [9,9-bis(2-phenylethyl)-7-trimethylsilylfluoren-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 153325067 |
| Molecular Formula | C35H42Si2 |
| Molecular Weight | 518.89 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | [9,9-bis(2-phenylethyl)-7-trimethylsilylfluoren-2-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc2c(c1)C(CCc1ccccc1)(CCc1ccccc1)c1cc([Si](C)(C)C)ccc1-2 |
| InChI | InChI=1S/C35H42Si2/c1-36(2,3)29-17-19-31-32-20-18-30(37(4,5)6)26-34(32)35(33(31)25-29,23-21-27-13-9-7-10-14-27)24-22-28-15-11-8-12-16-28/h7-20,25-26H,21-24H2,1-6H3 |
| InChIKey | GPNWGCKUTFQTPU-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.89 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|