C10H19Cl3OS3 — CID 153325240
1-[3-chloro-2-(2-chloroethylsulfanyl)propyl]sulfanyl-3-(2-chloroethylsulfanyl)propan-2-ol (PubChem CID 153325240) has the molecular formula C10H19Cl3OS3 and a molecular weight of 357.82 g/mol. Its IUPAC name is 1-[3-chloro-2-(2-chloroethylsulfanyl)propyl]sulfanyl-3-(2-chloroethylsulfanyl)propan-2-ol.
| Compound Name | 1-[3-chloro-2-(2-chloroethylsulfanyl)propyl]sulfanyl-3-(2-chloroethylsulfanyl)propan-2-ol |
|---|---|
| PubChem CID | 153325240 |
| Molecular Formula | C10H19Cl3OS3 |
| Molecular Weight | 357.82 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | 1-[3-chloro-2-(2-chloroethylsulfanyl)propyl]sulfanyl-3-(2-chloroethylsulfanyl)propan-2-ol |
| SMILES | OC(CSCCCl)CSCC(CCl)SCCCl |
| InChI | InChI=1S/C10H19Cl3OS3/c11-1-3-15-6-9(14)7-16-8-10(5-13)17-4-2-12/h9-10,14H,1-8H2 |
| InChIKey | QJUAVASIOHAUFH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.82 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|