C22H29ClFN4O8P — CID 153328154
cyclopentyl (2S)-2-[[[(2S,4S)-4-(6-amino-5-fluoro-2-oxo-1H-pyrimidin-3-ium-3-yl)-1,3-dioxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate chloride (PubChem CID 153328154) has the molecular formula C22H29ClFN4O8P and a molecular weight of 562.92 g/mol. Its IUPAC name is cyclopentyl (2S)-2-[[[(2S,4S)-4-(6-amino-5-fluoro-2-oxo-1H-pyrimidin-3-ium-3-yl)-1,3-dioxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate chloride.
| Compound Name | cyclopentyl (2S)-2-[[[(2S,4S)-4-(6-amino-5-fluoro-2-oxo-1H-pyrimidin-3-ium-3-yl)-1,3-dioxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate chloride |
|---|---|
| PubChem CID | 153328154 |
| Molecular Formula | C22H29ClFN4O8P |
| Molecular Weight | 562.92 g/mol |
| Exact Mass | 562.14 |
| IUPAC Name | cyclopentyl (2S)-2-[[[(2S,4S)-4-(6-amino-5-fluoro-2-oxo-1H-pyrimidin-3-ium-3-yl)-1,3-dioxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate chloride |
| SMILES | C[C@H](N[P@](=O)(OC[C@H]1OC[C@@H]([n+]2cc(F)c(N)[nH]c2=O)O1)Oc1ccccc1)C(=O)OC1CCCC1.[Cl-] |
| InChI | InChI=1S/C22H28FN4O8P.ClH/c1-14(21(28)33-15-7-5-6-8-15)26-36(30,35-16-9-3-2-4-10-16)32-13-19-31-12-18(34-19)27-11-17(23)20(24)25-22(27)29;/h2-4,9-11,14-15,18-19H,5-8,12-13H2,1H3,(H3,24,25,26,29,30);1H/t14-,18-,19-,36-;/m0./s1 |
| InChIKey | DINFSRXRQOEYMJ-DQHXQZATSA-N |
| XLogP | -1.07 |
| TPSA | 155.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.92 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|