C22H29FN4O8P+ — CID 158010845
cyclohexyl (2S)-2-[[[(2S,4S)-4-(6-amino-5-fluoro-2-oxo-1H-pyrimidin-3-ium-3-yl)-1,3-dioxolan-2-yl]oxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 158010845) has the molecular formula C22H29FN4O8P+ and a molecular weight of 527.47 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[[[(2S,4S)-4-(6-amino-5-fluoro-2-oxo-1H-pyrimidin-3-ium-3-yl)-1,3-dioxolan-2-yl]oxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl (2S)-2-[[[(2S,4S)-4-(6-amino-5-fluoro-2-oxo-1H-pyrimidin-3-ium-3-yl)-1,3-dioxolan-2-yl]oxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 158010845 |
| Molecular Formula | C22H29FN4O8P+ |
| Molecular Weight | 527.47 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | cyclohexyl (2S)-2-[[[(2S,4S)-4-(6-amino-5-fluoro-2-oxo-1H-pyrimidin-3-ium-3-yl)-1,3-dioxolan-2-yl]oxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](N[P@@](=O)(Oc1ccccc1)O[C@H]1OC[C@@H]([n+]2cc(F)c(N)[nH]c2=O)O1)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C22H28FN4O8P/c1-14(20(28)32-15-8-4-2-5-9-15)26-36(30,34-16-10-6-3-7-11-16)35-22-31-13-18(33-22)27-12-17(23)19(24)25-21(27)29/h3,6-7,10-12,14-15,18,22H,2,4-5,8-9,13H2,1H3,(H3,24,25,26,29,30)/p+1/t14-,18-,22-,36+/m0/s1 |
| InChIKey | GJGXVDHKAUGYEE-HWPDFJTMSA-O |
| XLogP | 2.27 |
| TPSA | 155.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.47 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|