About ethane;1-ethenyl-2-ethylsulfanyl-4,5-dimethylimidazole
ethane;1-ethenyl-2-ethylsulfanyl-4,5-dimethylimidazole (PubChem CID 153331338) has the molecular formula C13H26N2S
and a molecular weight of 242.43 g/mol. Its IUPAC name is ethane;1-ethenyl-2-ethylsulfanyl-4,5-dimethylimidazole.
Molecular Properties
| Compound Name | ethane;1-ethenyl-2-ethylsulfanyl-4,5-dimethylimidazole |
| PubChem CID | 153331338 |
| Molecular Formula | C13H26N2S |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | ethane;1-ethenyl-2-ethylsulfanyl-4,5-dimethylimidazole |
| SMILES | C=Cn1c(SCC)nc(C)c1C.CC.CC |
| InChI | InChI=1S/C9H14N2S.2C2H6/c1-5-11-8(4)7(3)10-9(11)12-6-2;2*1-2/h5H,1,6H2,2-4H3;2*1-2H3 |
| InChIKey | ZFCCJKWPFSRIDH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;1-ethenyl-2-ethylsulfanyl-4,5-dimethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethenyl-2-ethylsulfanyl-4,5-dimethylimidazole?
The IUPAC name of ethane;1-ethenyl-2-ethylsulfanyl-4,5-dimethylimidazole (CID 153331338) is ethane;1-ethenyl-2-ethylsulfanyl-4,5-dimethylimidazole.
What is the SMILES notation for ethane;1-ethenyl-2-ethylsulfanyl-4,5-dimethylimidazole?
The canonical SMILES for ethane;1-ethenyl-2-ethylsulfanyl-4,5-dimethylimidazole is C=Cn1c(SCC)nc(C)c1C.CC.CC.
What is the InChIKey of ethane;1-ethenyl-2-ethylsulfanyl-4,5-dimethylimidazole?
The InChIKey is ZFCCJKWPFSRIDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2S.2C2H6/c1-5-11-8(4)7(3)10-9(11)12-6-2;2*1-2/h5H,1,6H2,2-4H3;2*1-2H3.
What are the key properties of ethane;1-ethenyl-2-ethylsulfanyl-4,5-dimethylimidazole?
ethane;1-ethenyl-2-ethylsulfanyl-4,5-dimethylimidazole has a molecular weight of 242.43 g/mol, XLogP of 4.76, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethenyl-2-ethylsulfanyl-4,5-dimethylimidazole is sourced from PubChem (CID 153331338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).