C12H25LrN2O- — CID 153331427
CID 153331427 (PubChem CID 153331427) has the molecular formula C12H25LrN2O- and a molecular weight of 475.35 g/mol.
| Compound Name | CID 153331427 |
|---|---|
| PubChem CID | 153331427 |
| Molecular Formula | C12H25LrN2O- |
| Molecular Weight | 475.35 g/mol |
| Exact Mass | 475.31 |
| IUPAC Name | — |
| SMILES | C[C-]1CCCOCCN(C(C)C)CCN1.[Lr] |
| InChI | InChI=1S/C12H25N2O.Lr/c1-11(2)14-7-6-13-12(3)5-4-9-15-10-8-14;/h11,13H,4-10H2,1-3H3;/q-1; |
| InChIKey | VFTQJWLDPYYIFC-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|