C13H16O4 — CID 153333565
5,7-dimethoxy-2-methylidene-1-benzofuran-4-one;ethane (PubChem CID 153333565) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 5,7-dimethoxy-2-methylidene-1-benzofuran-4-one;ethane.
| Compound Name | 5,7-dimethoxy-2-methylidene-1-benzofuran-4-one;ethane |
|---|---|
| PubChem CID | 153333565 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 5,7-dimethoxy-2-methylidene-1-benzofuran-4-one;ethane |
| SMILES | C=c1cc2c(o1)=C(OC)C=C(OC)C2=O.CC |
| InChI | InChI=1S/C11H10O4.C2H6/c1-6-4-7-10(12)8(13-2)5-9(14-3)11(7)15-6;1-2/h4-5H,1H2,2-3H3;1-2H3 |
| InChIKey | ARUUIZKDDOJKEM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |