C44H31N3S — CID 153340763
N'-benzyl-N-[(6,8-diphenyl-4-pyridin-3-yldibenzothiophen-1-yl)methylidene]benzenecarboximidamide (PubChem CID 153340763) has the molecular formula C44H31N3S and a molecular weight of 633.82 g/mol. Its IUPAC name is N'-benzyl-N-[(6,8-diphenyl-4-pyridin-3-yldibenzothiophen-1-yl)methylidene]benzenecarboximidamide.
| Compound Name | N'-benzyl-N-[(6,8-diphenyl-4-pyridin-3-yldibenzothiophen-1-yl)methylidene]benzenecarboximidamide |
|---|---|
| PubChem CID | 153340763 |
| Molecular Formula | C44H31N3S |
| Molecular Weight | 633.82 g/mol |
| Exact Mass | 633.22 |
| IUPAC Name | N'-benzyl-N-[(6,8-diphenyl-4-pyridin-3-yldibenzothiophen-1-yl)methylidene]benzenecarboximidamide |
| SMILES | C(=N/C(=N/Cc1ccccc1)c1ccccc1)\c1ccc(-c2cccnc2)c2sc3c(-c4ccccc4)cc(-c4ccccc4)cc3c12 |
| InChI | InChI=1S/C44H31N3S/c1-5-14-31(15-6-1)28-46-44(34-20-11-4-12-21-34)47-30-36-23-24-38(35-22-13-25-45-29-35)43-41(36)40-27-37(32-16-7-2-8-17-32)26-39(42(40)48-43)33-18-9-3-10-19-33/h1-27,29-30H,28H2/b46-44+,47-30+ |
| InChIKey | ULDDVRRQCLXPGE-BOXAAKQTSA-N |
| XLogP | 11.52 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.82 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|