C57H40N2S — CID 153340605
N'-benzyl-N-[[4-(3,5-diphenylphenyl)-6,8-diphenyldibenzothiophen-1-yl]methylidene]benzenecarboximidamide (PubChem CID 153340605) has the molecular formula C57H40N2S and a molecular weight of 785.03 g/mol. Its IUPAC name is N'-benzyl-N-[[4-(3,5-diphenylphenyl)-6,8-diphenyldibenzothiophen-1-yl]methylidene]benzenecarboximidamide.
| Compound Name | N'-benzyl-N-[[4-(3,5-diphenylphenyl)-6,8-diphenyldibenzothiophen-1-yl]methylidene]benzenecarboximidamide |
|---|---|
| PubChem CID | 153340605 |
| Molecular Formula | C57H40N2S |
| Molecular Weight | 785.03 g/mol |
| Exact Mass | 784.29 |
| IUPAC Name | N'-benzyl-N-[[4-(3,5-diphenylphenyl)-6,8-diphenyldibenzothiophen-1-yl]methylidene]benzenecarboximidamide |
| SMILES | C(=N/C(=N/Cc1ccccc1)c1ccccc1)\c1ccc(-c2cc(-c3ccccc3)cc(-c3ccccc3)c2)c2sc3c(-c4ccccc4)cc(-c4ccccc4)cc3c12 |
| InChI | InChI=1S/C57H40N2S/c1-7-19-40(20-8-1)38-58-57(45-29-17-6-18-30-45)59-39-46-31-32-51(50-34-47(41-21-9-2-10-22-41)33-48(35-50)42-23-11-3-12-24-42)56-54(46)53-37-49(43-25-13-4-14-26-43)36-52(55(53)60-56)44-27-15-5-16-28-44/h1-37,39H,38H2/b58-57+,59-39+ |
| InChIKey | UNIFNWREAAGKKL-FVHUEXOYSA-N |
| XLogP | 15.46 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.03 |
| LogP ≤ 5 | 15.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|