C52H39N3OS — CID 153340590
N-methylidenedibenzofuran-4-carboximidamide;toluene;(4,6,8-triphenyldibenzothiophen-1-yl)methanimine (PubChem CID 153340590) has the molecular formula C52H39N3OS and a molecular weight of 753.97 g/mol. Its IUPAC name is N-methylidenedibenzofuran-4-carboximidamide;toluene;(4,6,8-triphenyldibenzothiophen-1-yl)methanimine.
| Compound Name | N-methylidenedibenzofuran-4-carboximidamide;toluene;(4,6,8-triphenyldibenzothiophen-1-yl)methanimine |
|---|---|
| PubChem CID | 153340590 |
| Molecular Formula | C52H39N3OS |
| Molecular Weight | 753.97 g/mol |
| Exact Mass | 753.28 |
| IUPAC Name | N-methylidenedibenzofuran-4-carboximidamide;toluene;(4,6,8-triphenyldibenzothiophen-1-yl)methanimine |
| SMILES | Cc1ccccc1.[H]/N=C(\N=C)c1cccc2c1oc1ccccc12.[H]/N=C/c1ccc(-c2ccccc2)c2sc3c(-c4ccccc4)cc(-c4ccccc4)cc3c12 |
| InChI | InChI=1S/C31H21NS.C14H10N2O.C7H8/c32-20-24-16-17-26(22-12-6-2-7-13-22)31-29(24)28-19-25(21-10-4-1-5-11-21)18-27(30(28)33-31)23-14-8-3-9-15-23;1-16-14(15)11-7-4-6-10-9-5-2-3-8-12(9)17-13(10)11;1-7-5-3-2-4-6-7/h1-20,32H;2-8,15H,1H2;2-6H,1H3/b32-20+;15-14-; |
| InChIKey | ZBYPQZBWDSENBD-JMNIZBRTSA-N |
| XLogP | 14.66 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.97 |
| LogP ≤ 5 | 14.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|