C53H38N4S — CID 153340662
N'-(benzenecarboximidoyl)-4-[4-(3-cyanophenyl)-6,8-diphenyldibenzothiophen-1-yl]-N-methylidenebenzenecarboximidamide;toluene (PubChem CID 153340662) has the molecular formula C53H38N4S and a molecular weight of 762.98 g/mol. Its IUPAC name is N'-(benzenecarboximidoyl)-4-[4-(3-cyanophenyl)-6,8-diphenyldibenzothiophen-1-yl]-N-methylidenebenzenecarboximidamide;toluene.
| Compound Name | N'-(benzenecarboximidoyl)-4-[4-(3-cyanophenyl)-6,8-diphenyldibenzothiophen-1-yl]-N-methylidenebenzenecarboximidamide;toluene |
|---|---|
| PubChem CID | 153340662 |
| Molecular Formula | C53H38N4S |
| Molecular Weight | 762.98 g/mol |
| Exact Mass | 762.28 |
| IUPAC Name | N'-(benzenecarboximidoyl)-4-[4-(3-cyanophenyl)-6,8-diphenyldibenzothiophen-1-yl]-N-methylidenebenzenecarboximidamide;toluene |
| SMILES | Cc1ccccc1.[H]/N=C(/N=C(/N=C)c1ccc(-c2ccc(-c3cccc(C#N)c3)c3sc4c(-c5ccccc5)cc(-c5ccccc5)cc4c23)cc1)c1ccccc1 |
| InChI | InChI=1S/C46H30N4S.C7H8/c1-49-46(50-45(48)34-17-9-4-10-18-34)35-22-20-33(21-23-35)38-24-25-39(36-19-11-12-30(26-36)29-47)44-42(38)41-28-37(31-13-5-2-6-14-31)27-40(43(41)51-44)32-15-7-3-8-16-32;1-7-5-3-2-4-6-7/h2-28,48H,1H2;2-6H,1H3/b48-45+,50-46+; |
| InChIKey | QPKOGSGCPFOFHG-VSIVDLAISA-N |
| XLogP | 14.06 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.98 |
| LogP ≤ 5 | 14.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|