C30H40N7O2+ — CID 153340875
[(3S)-3-hydroxy-3-methyl-1,2-dihydroinden-5-yl]-[4-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]-5-(prop-2-enylcarbamoyl)-1H-pyrimidin-4-yl]azanium (PubChem CID 153340875) has the molecular formula C30H40N7O2+ and a molecular weight of 530.70 g/mol. Its IUPAC name is [(3S)-3-hydroxy-3-methyl-1,2-dihydroinden-5-yl]-[4-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]-5-(prop-2-enylcarbamoyl)-1H-pyrimidin-4-yl]azanium.
| Compound Name | [(3S)-3-hydroxy-3-methyl-1,2-dihydroinden-5-yl]-[4-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]-5-(prop-2-enylcarbamoyl)-1H-pyrimidin-4-yl]azanium |
|---|---|
| PubChem CID | 153340875 |
| Molecular Formula | C30H40N7O2+ |
| Molecular Weight | 530.70 g/mol |
| Exact Mass | 530.32 |
| IUPAC Name | [(3S)-3-hydroxy-3-methyl-1,2-dihydroinden-5-yl]-[4-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]-5-(prop-2-enylcarbamoyl)-1H-pyrimidin-4-yl]azanium |
| SMILES | C=CCNC(=O)C1=CNC(Nc2ccc(N3CCN(C)CC3)cc2)=NC1(C)[NH2+]c1ccc2c(c1)[C@@](C)(O)CC2 |
| InChI | InChI=1S/C30H39N7O2/c1-5-14-31-27(38)26-20-32-28(33-22-8-10-24(11-9-22)37-17-15-36(4)16-18-37)35-30(26,3)34-23-7-6-21-12-13-29(2,39)25(21)19-23/h5-11,19-20,34,39H,1,12-18H2,2-4H3,(H,31,38)(H2,32,33,35)/p+1/t29-,30?/m0/s1 |
| InChIKey | QEFDTNZEWQFMKR-UFXYQILXSA-O |
| XLogP | 1.76 |
| TPSA | 108.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.70 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|