C36H49NO6 — CID 153341328
4-O-butyl 1-O-methyl (2R,3S)-2-[(4S)-5'-hept-6-enyl-7-methylspiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-yl]-2-hydroxy-3-methylbutanedioate (PubChem CID 153341328) has the molecular formula C36H49NO6 and a molecular weight of 591.79 g/mol. Its IUPAC name is 4-O-butyl 1-O-methyl (2R,3S)-2-[(4S)-5'-hept-6-enyl-7-methylspiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-yl]-2-hydroxy-3-methylbutanedioate.
| Compound Name | 4-O-butyl 1-O-methyl (2R,3S)-2-[(4S)-5'-hept-6-enyl-7-methylspiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-yl]-2-hydroxy-3-methylbutanedioate |
|---|---|
| PubChem CID | 153341328 |
| Molecular Formula | C36H49NO6 |
| Molecular Weight | 591.79 g/mol |
| Exact Mass | 591.36 |
| IUPAC Name | 4-O-butyl 1-O-methyl (2R,3S)-2-[(4S)-5'-hept-6-enyl-7-methylspiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-yl]-2-hydroxy-3-methylbutanedioate |
| SMILES | C=CCCCCCN1C[C@@]2(CCCc3cc(C)ccc32)COc2ccc([C@@](O)(C(=O)OC)[C@H](C)C(=O)OCCCC)cc21 |
| InChI | InChI=1S/C36H49NO6/c1-6-8-10-11-12-20-37-24-35(19-13-14-28-22-26(3)15-17-30(28)35)25-43-32-18-16-29(23-31(32)37)36(40,34(39)41-5)27(4)33(38)42-21-9-7-2/h6,15-18,22-23,27,40H,1,7-14,19-21,24-25H2,2-5H3/t27-,35+,36-/m1/s1 |
| InChIKey | IUBKXMVMIQNSDE-WOCSTVOOSA-N |
| XLogP | 6.55 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.79 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|