C32H42ClN3O6S — CID 153341409
(22R,23S,24E,31R)-31-carbamoyl-10-chloro-23,31-dihydroxy-19-methyl-5-oxa-17,29-diazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaene-29-sulfinic acid (PubChem CID 153341409) has the molecular formula C32H42ClN3O6S and a molecular weight of 632.22 g/mol. Its IUPAC name is (22R,23S,24E,31R)-31-carbamoyl-10-chloro-23,31-dihydroxy-19-methyl-5-oxa-17,29-diazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaene-29-sulfinic acid.
| Compound Name | (22R,23S,24E,31R)-31-carbamoyl-10-chloro-23,31-dihydroxy-19-methyl-5-oxa-17,29-diazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaene-29-sulfinic acid |
|---|---|
| PubChem CID | 153341409 |
| Molecular Formula | C32H42ClN3O6S |
| Molecular Weight | 632.22 g/mol |
| Exact Mass | 631.25 |
| IUPAC Name | (22R,23S,24E,31R)-31-carbamoyl-10-chloro-23,31-dihydroxy-19-methyl-5-oxa-17,29-diazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaene-29-sulfinic acid |
| SMILES | CC12CC[C@H]1[C@@H](O)/C=C\CCCN(S(=O)O)C[C@@](O)(C(N)=O)c1ccc3c(c1)N(CCCCc1cc(Cl)ccc1CO3)C2 |
| InChI | InChI=1S/C32H42ClN3O6S/c1-31-14-13-26(31)28(37)8-3-2-5-16-36(43(40)41)21-32(39,30(34)38)24-10-12-29-27(18-24)35(20-31)15-6-4-7-22-17-25(33)11-9-23(22)19-42-29/h3,8-12,17-18,26,28,37,39H,2,4-7,13-16,19-21H2,1H3,(H2,34,38)(H,40,41)/b8-3-/t26-,28-,31?,32-/m0/s1 |
| InChIKey | ZNDNXUDQHUBUIA-VCHWJASZSA-N |
| XLogP | 4.30 |
| TPSA | 136.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.22 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|