C22H25N5O2 — CID 153345009
5-[(4-methylidene-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-3-yl)methyl]-3-[(5R)-5-(4-methylphenyl)oxolan-3-yl]-1,2,4-oxadiazole (PubChem CID 153345009) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is 5-[(4-methylidene-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-3-yl)methyl]-3-[(5R)-5-(4-methylphenyl)oxolan-3-yl]-1,2,4-oxadiazole.
| Compound Name | 5-[(4-methylidene-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-3-yl)methyl]-3-[(5R)-5-(4-methylphenyl)oxolan-3-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 153345009 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 5-[(4-methylidene-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-3-yl)methyl]-3-[(5R)-5-(4-methylphenyl)oxolan-3-yl]-1,2,4-oxadiazole |
| SMILES | C=C1C2=C(CNCC2)N=CN1Cc1nc(C2CO[C@@H](c3ccc(C)cc3)C2)no1 |
| InChI | InChI=1S/C22H25N5O2/c1-14-3-5-16(6-4-14)20-9-17(12-28-20)22-25-21(29-26-22)11-27-13-24-19-10-23-8-7-18(19)15(27)2/h3-6,13,17,20,23H,2,7-12H2,1H3/t17?,20-/m1/s1 |
| InChIKey | LZYRCGYHGMZFSO-UUSAFJCLSA-N |
| XLogP | 3.23 |
| TPSA | 75.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |