C21H23FN6O2 — CID 153345129
N'-[1-[[3-[(5R)-5-(4-fluorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-6-methylidenepyrimidin-4-yl]ethanimidamide (PubChem CID 153345129) has the molecular formula C21H23FN6O2 and a molecular weight of 410.45 g/mol. Its IUPAC name is N'-[1-[[3-[(5R)-5-(4-fluorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-6-methylidenepyrimidin-4-yl]ethanimidamide.
| Compound Name | N'-[1-[[3-[(5R)-5-(4-fluorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-6-methylidenepyrimidin-4-yl]ethanimidamide |
|---|---|
| PubChem CID | 153345129 |
| Molecular Formula | C21H23FN6O2 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | N'-[1-[[3-[(5R)-5-(4-fluorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-6-methylidenepyrimidin-4-yl]ethanimidamide |
| SMILES | C=C1C(C)=C(/N=C(\C)N)N=CN1Cc1nc(C2CO[C@@H](c3ccc(F)cc3)C2)no1 |
| InChI | InChI=1S/C21H23FN6O2/c1-12-13(2)28(11-24-20(12)25-14(3)23)9-19-26-21(27-30-19)16-8-18(29-10-16)15-4-6-17(22)7-5-15/h4-7,11,16,18H,2,8-10H2,1,3H3,(H2,23,25)/t16?,18-/m1/s1 |
| InChIKey | GBHSDZRNLXHUKV-UHUGOGIASA-N |
| XLogP | 3.42 |
| TPSA | 102.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|