C12H21N3 — CID 153352369
N-[(Z)-2-cyclohexa-1,5-dien-1-yl-2-hydrazinylethenyl]butan-1-amine (PubChem CID 153352369) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is N-[(Z)-2-cyclohexa-1,5-dien-1-yl-2-hydrazinylethenyl]butan-1-amine.
| Compound Name | N-[(Z)-2-cyclohexa-1,5-dien-1-yl-2-hydrazinylethenyl]butan-1-amine |
|---|---|
| PubChem CID | 153352369 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | N-[(Z)-2-cyclohexa-1,5-dien-1-yl-2-hydrazinylethenyl]butan-1-amine |
| SMILES | CCCCN/C=C(\NN)C1=CCCC=C1 |
| InChI | InChI=1S/C12H21N3/c1-2-3-9-14-10-12(15-13)11-7-5-4-6-8-11/h5,7-8,10,14-15H,2-4,6,9,13H2,1H3/b12-10- |
| InChIKey | IUUYCJIDNISZCB-BENRWUELSA-N |
| XLogP | 1.96 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|