C30H41NO5 — CID 153355997
[2-oxo-2-(3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethyl] 2-(4-nitrophenyl)acetate (PubChem CID 153355997) has the molecular formula C30H41NO5 and a molecular weight of 495.66 g/mol. Its IUPAC name is [2-oxo-2-(3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethyl] 2-(4-nitrophenyl)acetate.
| Compound Name | [2-oxo-2-(3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethyl] 2-(4-nitrophenyl)acetate |
|---|---|
| PubChem CID | 153355997 |
| Molecular Formula | C30H41NO5 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.30 |
| IUPAC Name | [2-oxo-2-(3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethyl] 2-(4-nitrophenyl)acetate |
| SMILES | CC1CCC2(C)C(CCC3C2CCC2(C)C(C(=O)COC(=O)Cc4ccc([N+](=O)[O-])cc4)CCC32)C1 |
| InChI | InChI=1S/C30H41NO5/c1-19-12-14-29(2)21(16-19)6-9-23-24-10-11-26(30(24,3)15-13-25(23)29)27(32)18-36-28(33)17-20-4-7-22(8-5-20)31(34)35/h4-5,7-8,19,21,23-26H,6,9-18H2,1-3H3 |
| InChIKey | SSHVZWHAMRDZNK-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|